C26H50O4S2Si2 — CID 10530639
(5R)-5-[(2S,5S)-5-[(2R,5R)-5-[(1R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]ethyl]thiolan-2-yl]thiolan-2-yl]oxolan-2-one (PubChem CID 10530639) has the molecular formula C26H50O4S2Si2 and a molecular weight of 546.99 g/mol. Its IUPAC name is (5R)-5-[(2S,5S)-5-[(2R,5R)-5-[(1R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]ethyl]thiolan-2-yl]thiolan-2-yl]oxolan-2-one.
| Compound Name | (5R)-5-[(2S,5S)-5-[(2R,5R)-5-[(1R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]ethyl]thiolan-2-yl]thiolan-2-yl]oxolan-2-one |
|---|---|
| PubChem CID | 10530639 |
| Molecular Formula | C26H50O4S2Si2 |
| Molecular Weight | 546.99 g/mol |
| Exact Mass | 546.27 |
| IUPAC Name | (5R)-5-[(2S,5S)-5-[(2R,5R)-5-[(1R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]ethyl]thiolan-2-yl]thiolan-2-yl]oxolan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1CC[C@H]([C@@H]2CC[C@@H]([C@H]3CCC(=O)O3)S2)S1 |
| InChI | InChI=1S/C26H50O4S2Si2/c1-25(2,3)33(7,8)28-17-19(30-34(9,10)26(4,5)6)21-13-15-23(32-21)22-14-12-20(31-22)18-11-16-24(27)29-18/h18-23H,11-17H2,1-10H3/t18-,19-,20+,21-,22+,23-/m1/s1 |
| InChIKey | LIWHQMUXNKJUHH-IROFBDHCSA-N |
| XLogP | 7.63 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.99 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|