About [(5R)-5-[(1R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]ethyl]thiolan-2-yl] acetate
[(5R)-5-[(1R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]ethyl]thiolan-2-yl] acetate (PubChem CID 10812763) has the molecular formula C20H42O4SSi2
and a molecular weight of 434.79 g/mol. Its IUPAC name is [(5R)-5-[(1R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]ethyl]thiolan-2-yl] acetate.
Molecular Properties
| Compound Name | [(5R)-5-[(1R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]ethyl]thiolan-2-yl] acetate |
| PubChem CID | 10812763 |
| Molecular Formula | C20H42O4SSi2 |
| Molecular Weight | 434.79 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | [(5R)-5-[(1R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]ethyl]thiolan-2-yl] acetate |
| SMILES | CC(=O)OC1CC[C@H]([C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)S1 |
| InChI | InChI=1S/C20H42O4SSi2/c1-15(21)23-18-13-12-17(25-18)16(24-27(10,11)20(5,6)7)14-22-26(8,9)19(2,3)4/h16-18H,12-14H2,1-11H3/t16-,17-,18?/m1/s1 |
| InChIKey | RQNVDKFFDNLJHQ-OWZOALSMSA-N |
| XLogP | 6.18 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 434.79 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(5R)-5-[(1R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]ethyl]thiolan-2-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(5R)-5-[(1R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]ethyl]thiolan-2-yl] acetate?
The IUPAC name of [(5R)-5-[(1R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]ethyl]thiolan-2-yl] acetate (CID 10812763) is [(5R)-5-[(1R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]ethyl]thiolan-2-yl] acetate.
What is the SMILES notation for [(5R)-5-[(1R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]ethyl]thiolan-2-yl] acetate?
The canonical SMILES for [(5R)-5-[(1R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]ethyl]thiolan-2-yl] acetate is CC(=O)OC1CC[C@H]([C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)S1.
What is the InChIKey of [(5R)-5-[(1R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]ethyl]thiolan-2-yl] acetate?
The InChIKey is RQNVDKFFDNLJHQ-OWZOALSMSA-N. The full InChI is InChI=1S/C20H42O4SSi2/c1-15(21)23-18-13-12-17(25-18)16(24-27(10,11)20(5,6)7)14-22-26(8,9)19(2,3)4/h16-18H,12-14H2,1-11H3/t16-,17-,18?/m1/s1.
What are the key properties of [(5R)-5-[(1R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]ethyl]thiolan-2-yl] acetate?
[(5R)-5-[(1R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]ethyl]thiolan-2-yl] acetate has a molecular weight of 434.79 g/mol, XLogP of 6.18, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(5R)-5-[(1R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]ethyl]thiolan-2-yl] acetate is sourced from PubChem (CID 10812763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).