C20H42O4SSi2 — CID 10812763
[(5R)-5-[(1R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]ethyl]thiolan-2-yl] acetate (PubChem CID 10812763) has the molecular formula C20H42O4SSi2 and a molecular weight of 434.79 g/mol. Its IUPAC name is [(5R)-5-[(1R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]ethyl]thiolan-2-yl] acetate.
| Compound Name | [(5R)-5-[(1R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]ethyl]thiolan-2-yl] acetate |
|---|---|
| PubChem CID | 10812763 |
| Molecular Formula | C20H42O4SSi2 |
| Molecular Weight | 434.79 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | [(5R)-5-[(1R)-1,2-bis[[tert-butyl(dimethyl)silyl]oxy]ethyl]thiolan-2-yl] acetate |
| SMILES | CC(=O)OC1CC[C@H]([C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)S1 |
| InChI | InChI=1S/C20H42O4SSi2/c1-15(21)23-18-13-12-17(25-18)16(24-27(10,11)20(5,6)7)14-22-26(8,9)19(2,3)4/h16-18H,12-14H2,1-11H3/t16-,17-,18?/m1/s1 |
| InChIKey | RQNVDKFFDNLJHQ-OWZOALSMSA-N |
| XLogP | 6.18 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.79 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|