C16H30O3SSi — CID 117070935
[(9R)-9-[tert-butyl(dimethyl)silyl]oxy-1-thiaspiro[4.4]nonan-2-yl] acetate (PubChem CID 117070935) has the molecular formula C16H30O3SSi and a molecular weight of 330.57 g/mol. Its IUPAC name is [(9R)-9-[tert-butyl(dimethyl)silyl]oxy-1-thiaspiro[4.4]nonan-2-yl] acetate.
| Compound Name | [(9R)-9-[tert-butyl(dimethyl)silyl]oxy-1-thiaspiro[4.4]nonan-2-yl] acetate |
|---|---|
| PubChem CID | 117070935 |
| Molecular Formula | C16H30O3SSi |
| Molecular Weight | 330.57 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | [(9R)-9-[tert-butyl(dimethyl)silyl]oxy-1-thiaspiro[4.4]nonan-2-yl] acetate |
| SMILES | CC(=O)OC1CCC2(CCC[C@H]2O[Si](C)(C)C(C)(C)C)S1 |
| InChI | InChI=1S/C16H30O3SSi/c1-12(17)18-14-9-11-16(20-14)10-7-8-13(16)19-21(5,6)15(2,3)4/h13-14H,7-11H2,1-6H3/t13-,14?,16?/m1/s1 |
| InChIKey | BRHNJUMRRTVUJY-VQCLRJIVSA-N |
| XLogP | 4.72 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.57 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|