C15H30O2SSi — CID 99772696
tert-butyl-[[(2S,5S,9S)-2-methoxy-1-thiaspiro[4.4]nonan-9-yl]oxy]-dimethylsilane (PubChem CID 99772696) has the molecular formula C15H30O2SSi and a molecular weight of 302.56 g/mol. Its IUPAC name is tert-butyl-[[(2S,5S,9S)-2-methoxy-1-thiaspiro[4.4]nonan-9-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(2S,5S,9S)-2-methoxy-1-thiaspiro[4.4]nonan-9-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 99772696 |
| Molecular Formula | C15H30O2SSi |
| Molecular Weight | 302.56 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | tert-butyl-[[(2S,5S,9S)-2-methoxy-1-thiaspiro[4.4]nonan-9-yl]oxy]-dimethylsilane |
| SMILES | CO[C@@H]1CC[C@]2(CCC[C@@H]2O[Si](C)(C)C(C)(C)C)S1 |
| InChI | InChI=1S/C15H30O2SSi/c1-14(2,3)19(5,6)17-12-8-7-10-15(12)11-9-13(16-4)18-15/h12-13H,7-11H2,1-6H3/t12-,13-,15-/m0/s1 |
| InChIKey | WKDZEVCUOKEMPE-YDHLFZDLSA-N |
| XLogP | 4.80 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.56 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|