C14H26O2SSi — CID 117070880
tert-butyl-dimethyl-[[(9R)-1-oxo-1λ4-thiaspiro[4.4]non-2-en-9-yl]oxy]silane (PubChem CID 117070880) has the molecular formula C14H26O2SSi and a molecular weight of 286.51 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(9R)-1-oxo-1λ4-thiaspiro[4.4]non-2-en-9-yl]oxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(9R)-1-oxo-1λ4-thiaspiro[4.4]non-2-en-9-yl]oxy]silane |
|---|---|
| PubChem CID | 117070880 |
| Molecular Formula | C14H26O2SSi |
| Molecular Weight | 286.51 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | tert-butyl-dimethyl-[[(9R)-1-oxo-1λ4-thiaspiro[4.4]non-2-en-9-yl]oxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CCCC12CC=CS2=O |
| InChI | InChI=1S/C14H26O2SSi/c1-13(2,3)18(4,5)16-12-8-6-9-14(12)10-7-11-17(14)15/h7,11-12H,6,8-10H2,1-5H3/t12-,14?,17?/m1/s1 |
| InChIKey | RXHSIINQQBLLBW-RFSCMCKOSA-N |
| XLogP | 3.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.51 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|