C16H30O3Si — CID 11779460
(4R,5R,9R)-4-[tert-butyl(dimethyl)silyl]oxyspiro[4.4]nonane-9-carboxylic acid (PubChem CID 11779460) has the molecular formula C16H30O3Si and a molecular weight of 298.50 g/mol. Its IUPAC name is (4R,5R,9R)-4-[tert-butyl(dimethyl)silyl]oxyspiro[4.4]nonane-9-carboxylic acid.
| Compound Name | (4R,5R,9R)-4-[tert-butyl(dimethyl)silyl]oxyspiro[4.4]nonane-9-carboxylic acid |
|---|---|
| PubChem CID | 11779460 |
| Molecular Formula | C16H30O3Si |
| Molecular Weight | 298.50 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | (4R,5R,9R)-4-[tert-butyl(dimethyl)silyl]oxyspiro[4.4]nonane-9-carboxylic acid |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CCC[C@@]12CCC[C@H]2C(=O)O |
| InChI | InChI=1S/C16H30O3Si/c1-15(2,3)20(4,5)19-13-9-7-11-16(13)10-6-8-12(16)14(17)18/h12-13H,6-11H2,1-5H3,(H,17,18)/t12-,13+,16+/m0/s1 |
| InChIKey | GLHYNASHVRWQFK-WOSRLPQWSA-N |
| XLogP | 4.43 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.50 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|