C19H33F3O6SSi — CID 101385416
[(2'S,3aR,4S,6S,6aR)-2'-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylspiro[3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxole-4,1'-cyclopentane]-6-yl] trifluoromethanesulfonate (PubChem CID 101385416) has the molecular formula C19H33F3O6SSi and a molecular weight of 474.61 g/mol. Its IUPAC name is [(2'S,3aR,4S,6S,6aR)-2'-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylspiro[3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxole-4,1'-cyclopentane]-6-yl] trifluoromethanesulfonate.
| Compound Name | [(2'S,3aR,4S,6S,6aR)-2'-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylspiro[3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxole-4,1'-cyclopentane]-6-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 101385416 |
| Molecular Formula | C19H33F3O6SSi |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | [(2'S,3aR,4S,6S,6aR)-2'-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethylspiro[3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxole-4,1'-cyclopentane]-6-yl] trifluoromethanesulfonate |
| SMILES | CC1(C)O[C@H]2[C@@H](OS(=O)(=O)C(F)(F)F)C[C@@]3(CCC[C@@H]3O[Si](C)(C)C(C)(C)C)[C@H]2O1 |
| InChI | InChI=1S/C19H33F3O6SSi/c1-16(2,3)30(6,7)28-13-9-8-10-18(13)11-12(27-29(23,24)19(20,21)22)14-15(18)26-17(4,5)25-14/h12-15H,8-11H2,1-7H3/t12-,13-,14-,15-,18+/m0/s1 |
| InChIKey | PENZDXGBZPXIJH-QHLBIMPKSA-N |
| XLogP | 4.71 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|