C29H49F3O4SSi — CID 24886166
[(3S,5R,8R,9R,10R,13R,14S)-3-[tert-butyl(dimethyl)silyl]oxy-4,4,8,10,13-pentamethyl-2,3,5,6,7,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl] trifluoromethanesulfonate (PubChem CID 24886166) has the molecular formula C29H49F3O4SSi and a molecular weight of 578.85 g/mol. Its IUPAC name is [(3S,5R,8R,9R,10R,13R,14S)-3-[tert-butyl(dimethyl)silyl]oxy-4,4,8,10,13-pentamethyl-2,3,5,6,7,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl] trifluoromethanesulfonate.
| Compound Name | [(3S,5R,8R,9R,10R,13R,14S)-3-[tert-butyl(dimethyl)silyl]oxy-4,4,8,10,13-pentamethyl-2,3,5,6,7,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 24886166 |
| Molecular Formula | C29H49F3O4SSi |
| Molecular Weight | 578.85 g/mol |
| Exact Mass | 578.31 |
| IUPAC Name | [(3S,5R,8R,9R,10R,13R,14S)-3-[tert-butyl(dimethyl)silyl]oxy-4,4,8,10,13-pentamethyl-2,3,5,6,7,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-17-yl] trifluoromethanesulfonate |
| SMILES | CC1(C)[C@@H](O[Si](C)(C)C(C)(C)C)CC[C@]2(C)[C@H]3CC[C@@]4(C)C(OS(=O)(=O)C(F)(F)F)=CC[C@H]4[C@]3(C)CC[C@@H]12 |
| InChI | InChI=1S/C29H49F3O4SSi/c1-24(2,3)38(9,10)36-22-15-18-26(6)19(25(22,4)5)13-16-27(7)20-11-12-23(28(20,8)17-14-21(26)27)35-37(33,34)29(30,31)32/h12,19-22H,11,13-18H2,1-10H3/t19-,20-,21+,22-,26-,27-,28+/m0/s1 |
| InChIKey | BADPUZNXODYABA-ODNVXAONSA-N |
| XLogP | 8.81 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.85 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|