C41H64O2Si2 — CID 10770464
[(1S,4aR,4bS,7R,8aS,10aR)-7-[tert-butyl(dimethyl)silyl]oxy-1,4b,8,8-tetramethyl-1,2,4a,5,6,7,8a,9,10,10a-decahydrophenanthren-2-yl]methoxy-tert-butyl-diphenylsilane (PubChem CID 10770464) has the molecular formula C41H64O2Si2 and a molecular weight of 645.13 g/mol. Its IUPAC name is [(1S,4aR,4bS,7R,8aS,10aR)-7-[tert-butyl(dimethyl)silyl]oxy-1,4b,8,8-tetramethyl-1,2,4a,5,6,7,8a,9,10,10a-decahydrophenanthren-2-yl]methoxy-tert-butyl-diphenylsilane.
| Compound Name | [(1S,4aR,4bS,7R,8aS,10aR)-7-[tert-butyl(dimethyl)silyl]oxy-1,4b,8,8-tetramethyl-1,2,4a,5,6,7,8a,9,10,10a-decahydrophenanthren-2-yl]methoxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 10770464 |
| Molecular Formula | C41H64O2Si2 |
| Molecular Weight | 645.13 g/mol |
| Exact Mass | 644.44 |
| IUPAC Name | [(1S,4aR,4bS,7R,8aS,10aR)-7-[tert-butyl(dimethyl)silyl]oxy-1,4b,8,8-tetramethyl-1,2,4a,5,6,7,8a,9,10,10a-decahydrophenanthren-2-yl]methoxy-tert-butyl-diphenylsilane |
| SMILES | C[C@@H]1C(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C=C[C@@H]2[C@@H]1CC[C@@H]1C(C)(C)[C@H](O[Si](C)(C)C(C)(C)C)CC[C@@]21C |
| InChI | InChI=1S/C41H64O2Si2/c1-30-31(29-42-45(39(5,6)7,32-19-15-13-16-20-32)33-21-17-14-18-22-33)23-25-35-34(30)24-26-36-40(8,9)37(27-28-41(35,36)10)43-44(11,12)38(2,3)4/h13-23,25,30-31,34-37H,24,26-29H2,1-12H3/t30-,31?,34-,35-,36-,37-,41+/m1/s1 |
| InChIKey | ZYXDCNVPZMCOEU-HJCRVQBPSA-N |
| XLogP | 10.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.13 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|