C32H44O3Si — CID 135055431
tert-butyl-[[(2R,3S,8R,9S)-8-but-2-ynyl-3,9-dimethyl-1,7-dioxaspiro[5.5]undecan-2-yl]methoxy]-diphenylsilane (PubChem CID 135055431) has the molecular formula C32H44O3Si and a molecular weight of 504.79 g/mol. Its IUPAC name is tert-butyl-[[(2R,3S,8R,9S)-8-but-2-ynyl-3,9-dimethyl-1,7-dioxaspiro[5.5]undecan-2-yl]methoxy]-diphenylsilane.
| Compound Name | tert-butyl-[[(2R,3S,8R,9S)-8-but-2-ynyl-3,9-dimethyl-1,7-dioxaspiro[5.5]undecan-2-yl]methoxy]-diphenylsilane |
|---|---|
| PubChem CID | 135055431 |
| Molecular Formula | C32H44O3Si |
| Molecular Weight | 504.79 g/mol |
| Exact Mass | 504.31 |
| IUPAC Name | tert-butyl-[[(2R,3S,8R,9S)-8-but-2-ynyl-3,9-dimethyl-1,7-dioxaspiro[5.5]undecan-2-yl]methoxy]-diphenylsilane |
| SMILES | CC#CC[C@H]1OC2(CC[C@H](C)[C@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)O2)CC[C@@H]1C |
| InChI | InChI=1S/C32H44O3Si/c1-7-8-19-29-25(2)20-22-32(34-29)23-21-26(3)30(35-32)24-33-36(31(4,5)6,27-15-11-9-12-16-27)28-17-13-10-14-18-28/h9-18,25-26,29-30H,19-24H2,1-6H3/t25-,26-,29+,30-,32?/m0/s1 |
| InChIKey | TXNVNMKQOJJRFT-FWCZMPNHSA-N |
| XLogP | 6.30 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.79 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|