C34H46O6Si — CID 157271692
1-[(1S,2S,7S,9S,12R)-7-[[tert-butyl(diphenyl)silyl]oxymethyl]spiro[3,5,8,13-tetraoxatricyclo[7.4.0.02,6]tridecane-4,1'-cyclohexane]-12-yl]propan-2-one (PubChem CID 157271692) has the molecular formula C34H46O6Si and a molecular weight of 578.82 g/mol. Its IUPAC name is 1-[(1S,2S,7S,9S,12R)-7-[[tert-butyl(diphenyl)silyl]oxymethyl]spiro[3,5,8,13-tetraoxatricyclo[7.4.0.02,6]tridecane-4,1'-cyclohexane]-12-yl]propan-2-one.
| Compound Name | 1-[(1S,2S,7S,9S,12R)-7-[[tert-butyl(diphenyl)silyl]oxymethyl]spiro[3,5,8,13-tetraoxatricyclo[7.4.0.02,6]tridecane-4,1'-cyclohexane]-12-yl]propan-2-one |
|---|---|
| PubChem CID | 157271692 |
| Molecular Formula | C34H46O6Si |
| Molecular Weight | 578.82 g/mol |
| Exact Mass | 578.31 |
| IUPAC Name | 1-[(1S,2S,7S,9S,12R)-7-[[tert-butyl(diphenyl)silyl]oxymethyl]spiro[3,5,8,13-tetraoxatricyclo[7.4.0.02,6]tridecane-4,1'-cyclohexane]-12-yl]propan-2-one |
| SMILES | CC(=O)C[C@H]1CC[C@@H]2O[C@@H](CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)C3OC4(CCCCC4)O[C@H]3[C@H]2O1 |
| InChI | InChI=1S/C34H46O6Si/c1-24(35)22-25-18-19-28-30(37-25)32-31(39-34(40-32)20-12-7-13-21-34)29(38-28)23-36-41(33(2,3)4,26-14-8-5-9-15-26)27-16-10-6-11-17-27/h5-6,8-11,14-17,25,28-32H,7,12-13,18-23H2,1-4H3/t25-,28+,29+,30+,31?,32+/m1/s1 |
| InChIKey | PLSBDHWTVDTGNR-ARHFBWQNSA-N |
| XLogP | 5.30 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.82 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|