C25H34O7 — CID 167058962
methyl 2-[(9S)-7-(phenylmethoxymethyl)spiro[3,5,8,13-tetraoxatricyclo[7.4.0.02,6]tridecane-4,1'-cyclohexane]-12-yl]acetate (PubChem CID 167058962) has the molecular formula C25H34O7 and a molecular weight of 446.54 g/mol. Its IUPAC name is methyl 2-[(9S)-7-(phenylmethoxymethyl)spiro[3,5,8,13-tetraoxatricyclo[7.4.0.02,6]tridecane-4,1'-cyclohexane]-12-yl]acetate.
| Compound Name | methyl 2-[(9S)-7-(phenylmethoxymethyl)spiro[3,5,8,13-tetraoxatricyclo[7.4.0.02,6]tridecane-4,1'-cyclohexane]-12-yl]acetate |
|---|---|
| PubChem CID | 167058962 |
| Molecular Formula | C25H34O7 |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.23 |
| IUPAC Name | methyl 2-[(9S)-7-(phenylmethoxymethyl)spiro[3,5,8,13-tetraoxatricyclo[7.4.0.02,6]tridecane-4,1'-cyclohexane]-12-yl]acetate |
| SMILES | COC(=O)CC1CC[C@@H]2OC(COCc3ccccc3)C3OC4(CCCCC4)OC3C2O1 |
| InChI | InChI=1S/C25H34O7/c1-27-21(26)14-18-10-11-19-22(29-18)24-23(31-25(32-24)12-6-3-7-13-25)20(30-19)16-28-15-17-8-4-2-5-9-17/h2,4-5,8-9,18-20,22-24H,3,6-7,10-16H2,1H3/t18?,19-,20?,22?,23?,24?/m0/s1 |
| InChIKey | PHKZBVJUPYBBHN-PKHODADASA-N |
| XLogP | 3.53 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |