C21H26O8 — CID 175251584
2-[(1S,2S,4R,7S,9S,10R,11R,13R)-10-hydroxy-11-(2-phenylmethoxyethyl)-3,8,12,14-tetraoxatetracyclo[9.2.1.02,7.09,13]tetradecan-4-yl]acetic acid (PubChem CID 175251584) has the molecular formula C21H26O8 and a molecular weight of 406.43 g/mol. Its IUPAC name is 2-[(1S,2S,4R,7S,9S,10R,11R,13R)-10-hydroxy-11-(2-phenylmethoxyethyl)-3,8,12,14-tetraoxatetracyclo[9.2.1.02,7.09,13]tetradecan-4-yl]acetic acid.
| Compound Name | 2-[(1S,2S,4R,7S,9S,10R,11R,13R)-10-hydroxy-11-(2-phenylmethoxyethyl)-3,8,12,14-tetraoxatetracyclo[9.2.1.02,7.09,13]tetradecan-4-yl]acetic acid |
|---|---|
| PubChem CID | 175251584 |
| Molecular Formula | C21H26O8 |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 2-[(1S,2S,4R,7S,9S,10R,11R,13R)-10-hydroxy-11-(2-phenylmethoxyethyl)-3,8,12,14-tetraoxatetracyclo[9.2.1.02,7.09,13]tetradecan-4-yl]acetic acid |
| SMILES | O=C(O)C[C@H]1CC[C@@H]2O[C@@H]3[C@H]4OC(CCOCc5ccccc5)(O[C@H]4[C@H]2O1)[C@@H]3O |
| InChI | InChI=1S/C21H26O8/c22-15(23)10-13-6-7-14-16(26-13)17-18-19(27-14)20(24)21(28-17,29-18)8-9-25-11-12-4-2-1-3-5-12/h1-5,13-14,16-20,24H,6-11H2,(H,22,23)/t13-,14+,16+,17+,18+,19-,20-,21?/m1/s1 |
| InChIKey | FKNHOZAVJPOYNA-TWOJYRSUSA-N |
| XLogP | 1.24 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|