C22H28O4 — CID 88675998
(5Z)-7-[(1S,2S,3R,4R)-3-(2-phenylmethoxyethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hepta-3,5-dienoic acid (PubChem CID 88675998) has the molecular formula C22H28O4 and a molecular weight of 356.46 g/mol. Its IUPAC name is (5Z)-7-[(1S,2S,3R,4R)-3-(2-phenylmethoxyethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hepta-3,5-dienoic acid.
| Compound Name | (5Z)-7-[(1S,2S,3R,4R)-3-(2-phenylmethoxyethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hepta-3,5-dienoic acid |
|---|---|
| PubChem CID | 88675998 |
| Molecular Formula | C22H28O4 |
| Molecular Weight | 356.46 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | (5Z)-7-[(1S,2S,3R,4R)-3-(2-phenylmethoxyethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hepta-3,5-dienoic acid |
| SMILES | O=C(O)CC=C/C=C\C[C@H]1[C@@H](CCOCc2ccccc2)[C@H]2CC[C@@H]1O2 |
| InChI | InChI=1S/C22H28O4/c23-22(24)11-7-2-1-6-10-18-19(21-13-12-20(18)26-21)14-15-25-16-17-8-4-3-5-9-17/h1-9,18-21H,10-16H2,(H,23,24)/b6-1-,7-2?/t18-,19+,20-,21+/m0/s1 |
| InChIKey | SZMDTAYHMHJJAK-PTNBIDTHSA-N |
| XLogP | 4.36 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.46 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|