C21H24O6 — CID 155766264
[(2S,3S,4R)-4,5-dihydroxy-3-(2-phenylmethoxyethyl)oxolan-2-yl]methyl benzoate (PubChem CID 155766264) has the molecular formula C21H24O6 and a molecular weight of 372.42 g/mol. Its IUPAC name is [(2S,3S,4R)-4,5-dihydroxy-3-(2-phenylmethoxyethyl)oxolan-2-yl]methyl benzoate.
| Compound Name | [(2S,3S,4R)-4,5-dihydroxy-3-(2-phenylmethoxyethyl)oxolan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 155766264 |
| Molecular Formula | C21H24O6 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | [(2S,3S,4R)-4,5-dihydroxy-3-(2-phenylmethoxyethyl)oxolan-2-yl]methyl benzoate |
| SMILES | O=C(OC[C@H]1OC(O)[C@H](O)[C@@H]1CCOCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H24O6/c22-19-17(11-12-25-13-15-7-3-1-4-8-15)18(27-21(19)24)14-26-20(23)16-9-5-2-6-10-16/h1-10,17-19,21-22,24H,11-14H2/t17-,18-,19-,21?/m1/s1 |
| InChIKey | XEUBHYKGEBTWQU-OCQFDOBUSA-N |
| XLogP | 2.14 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|