C13H18O6 — CID 90672360
(3S,4R,5S,6S)-6-(phenylmethoxymethyl)oxane-2,3,4,5-tetrol (PubChem CID 90672360) has the molecular formula C13H18O6 and a molecular weight of 270.28 g/mol. Its IUPAC name is (3S,4R,5S,6S)-6-(phenylmethoxymethyl)oxane-2,3,4,5-tetrol.
| Compound Name | (3S,4R,5S,6S)-6-(phenylmethoxymethyl)oxane-2,3,4,5-tetrol |
|---|---|
| PubChem CID | 90672360 |
| Molecular Formula | C13H18O6 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | (3S,4R,5S,6S)-6-(phenylmethoxymethyl)oxane-2,3,4,5-tetrol |
| SMILES | OC1O[C@@H](COCc2ccccc2)[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H18O6/c14-10-9(19-13(17)12(16)11(10)15)7-18-6-8-4-2-1-3-5-8/h1-5,9-17H,6-7H2/t9-,10+,11+,12-,13?/m0/s1 |
| InChIKey | UHHWQCVQKLCBMI-VNXCBOPGSA-N |
| XLogP | -1.00 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |