C20H25NO5 — CID 102126208
(3R,4R,5S,6R)-3-(benzylamino)-6-(phenylmethoxymethyl)oxane-2,4,5-triol (PubChem CID 102126208) has the molecular formula C20H25NO5 and a molecular weight of 359.42 g/mol. Its IUPAC name is (3R,4R,5S,6R)-3-(benzylamino)-6-(phenylmethoxymethyl)oxane-2,4,5-triol.
| Compound Name | (3R,4R,5S,6R)-3-(benzylamino)-6-(phenylmethoxymethyl)oxane-2,4,5-triol |
|---|---|
| PubChem CID | 102126208 |
| Molecular Formula | C20H25NO5 |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | (3R,4R,5S,6R)-3-(benzylamino)-6-(phenylmethoxymethyl)oxane-2,4,5-triol |
| SMILES | OC1O[C@H](COCc2ccccc2)[C@@H](O)[C@H](O)[C@H]1NCc1ccccc1 |
| InChI | InChI=1S/C20H25NO5/c22-18-16(13-25-12-15-9-5-2-6-10-15)26-20(24)17(19(18)23)21-11-14-7-3-1-4-8-14/h1-10,16-24H,11-13H2/t16-,17-,18-,19-,20?/m1/s1 |
| InChIKey | KOXZMTNFUMXZIB-MGXUXCEGSA-N |
| XLogP | 0.80 |
| TPSA | 91.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |