C22H27NO4 — CID 25023230
(2S,3S,4R,5R)-4-phenylmethoxy-5-(phenylmethoxymethyl)-3-(prop-2-enylamino)oxolan-2-ol (PubChem CID 25023230) has the molecular formula C22H27NO4 and a molecular weight of 369.46 g/mol. Its IUPAC name is (2S,3S,4R,5R)-4-phenylmethoxy-5-(phenylmethoxymethyl)-3-(prop-2-enylamino)oxolan-2-ol.
| Compound Name | (2S,3S,4R,5R)-4-phenylmethoxy-5-(phenylmethoxymethyl)-3-(prop-2-enylamino)oxolan-2-ol |
|---|---|
| PubChem CID | 25023230 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | (2S,3S,4R,5R)-4-phenylmethoxy-5-(phenylmethoxymethyl)-3-(prop-2-enylamino)oxolan-2-ol |
| SMILES | C=CCN[C@H]1[C@@H](OCc2ccccc2)[C@@H](COCc2ccccc2)O[C@@H]1O |
| InChI | InChI=1S/C22H27NO4/c1-2-13-23-20-21(26-15-18-11-7-4-8-12-18)19(27-22(20)24)16-25-14-17-9-5-3-6-10-17/h2-12,19-24H,1,13-16H2/t19-,20+,21+,22+/m1/s1 |
| InChIKey | YNAYDZSMQXDJLA-MLNNCEHLSA-N |
| XLogP | 2.65 |
| TPSA | 59.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|