C23H38O4 — CID 88676002
(5Z)-7-[(1S,2S,3R,4R)-3-(4-hexoxybutyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hepta-3,5-dienoic acid (PubChem CID 88676002) has the molecular formula C23H38O4 and a molecular weight of 378.55 g/mol. Its IUPAC name is (5Z)-7-[(1S,2S,3R,4R)-3-(4-hexoxybutyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hepta-3,5-dienoic acid.
| Compound Name | (5Z)-7-[(1S,2S,3R,4R)-3-(4-hexoxybutyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hepta-3,5-dienoic acid |
|---|---|
| PubChem CID | 88676002 |
| Molecular Formula | C23H38O4 |
| Molecular Weight | 378.55 g/mol |
| Exact Mass | 378.28 |
| IUPAC Name | (5Z)-7-[(1S,2S,3R,4R)-3-(4-hexoxybutyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hepta-3,5-dienoic acid |
| SMILES | CCCCCCOCCCC[C@@H]1[C@H](C/C=C\C=CCC(=O)O)[C@@H]2CC[C@H]1O2 |
| InChI | InChI=1S/C23H38O4/c1-2-3-4-10-17-26-18-11-9-13-20-19(21-15-16-22(20)27-21)12-7-5-6-8-14-23(24)25/h5-8,19-22H,2-4,9-18H2,1H3,(H,24,25)/b7-5-,8-6?/t19-,20+,21-,22+/m0/s1 |
| InChIKey | ILEBYNSYHSEFBQ-GCPJTXIYSA-N |
| XLogP | 5.52 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.55 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|