C20H30O3 — CID 88675904
(5Z)-7-[(1S,2S,3R,4R)-3-(cyclohexylmethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hepta-3,5-dienoic acid (PubChem CID 88675904) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is (5Z)-7-[(1S,2S,3R,4R)-3-(cyclohexylmethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hepta-3,5-dienoic acid.
| Compound Name | (5Z)-7-[(1S,2S,3R,4R)-3-(cyclohexylmethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hepta-3,5-dienoic acid |
|---|---|
| PubChem CID | 88675904 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (5Z)-7-[(1S,2S,3R,4R)-3-(cyclohexylmethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hepta-3,5-dienoic acid |
| SMILES | O=C(O)CC=C/C=C\C[C@H]1[C@@H](CC2CCCCC2)[C@H]2CC[C@@H]1O2 |
| InChI | InChI=1S/C20H30O3/c21-20(22)11-7-2-1-6-10-16-17(19-13-12-18(16)23-19)14-15-8-4-3-5-9-15/h1-2,6-7,15-19H,3-5,8-14H2,(H,21,22)/b6-1-,7-2?/t16-,17+,18-,19+/m0/s1 |
| InChIKey | MIYTTXUBUWKBKP-MZTLBCBASA-N |
| XLogP | 4.73 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|