C19H26O4 — CID 88704941
(5Z)-7-[(1S,2S,3R,4R)-3-[(1E)-3-hydroxyhexa-1,5-dienyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hepta-3,5-dienoic acid (PubChem CID 88704941) has the molecular formula C19H26O4 and a molecular weight of 318.41 g/mol. Its IUPAC name is (5Z)-7-[(1S,2S,3R,4R)-3-[(1E)-3-hydroxyhexa-1,5-dienyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hepta-3,5-dienoic acid.
| Compound Name | (5Z)-7-[(1S,2S,3R,4R)-3-[(1E)-3-hydroxyhexa-1,5-dienyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hepta-3,5-dienoic acid |
|---|---|
| PubChem CID | 88704941 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | (5Z)-7-[(1S,2S,3R,4R)-3-[(1E)-3-hydroxyhexa-1,5-dienyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hepta-3,5-dienoic acid |
| SMILES | C=CCC(O)/C=C/[C@@H]1[C@H](C/C=C\C=CCC(=O)O)[C@@H]2CC[C@H]1O2 |
| InChI | InChI=1S/C19H26O4/c1-2-7-14(20)10-11-16-15(17-12-13-18(16)23-17)8-5-3-4-6-9-19(21)22/h2-6,10-11,14-18,20H,1,7-9,12-13H2,(H,21,22)/b5-3-,6-4?,11-10+/t14?,15-,16+,17-,18+/m0/s1 |
| InChIKey | PTLCIIAEXKLJPC-HXOVINIOSA-N |
| XLogP | 3.25 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|