C22H34O4S — CID 70454885
2-[(Z)-4-[(1S,2S,3R,4R)-3-[(E)-3-cycloheptyl-3-hydroxyprop-1-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]but-2-enyl]sulfanylacetic acid (PubChem CID 70454885) has the molecular formula C22H34O4S and a molecular weight of 394.58 g/mol. Its IUPAC name is 2-[(Z)-4-[(1S,2S,3R,4R)-3-[(E)-3-cycloheptyl-3-hydroxyprop-1-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]but-2-enyl]sulfanylacetic acid.
| Compound Name | 2-[(Z)-4-[(1S,2S,3R,4R)-3-[(E)-3-cycloheptyl-3-hydroxyprop-1-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]but-2-enyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 70454885 |
| Molecular Formula | C22H34O4S |
| Molecular Weight | 394.58 g/mol |
| Exact Mass | 394.22 |
| IUPAC Name | 2-[(Z)-4-[(1S,2S,3R,4R)-3-[(E)-3-cycloheptyl-3-hydroxyprop-1-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]but-2-enyl]sulfanylacetic acid |
| SMILES | O=C(O)CSC/C=C\C[C@H]1[C@@H](/C=C/C(O)C2CCCCCC2)[C@H]2CC[C@@H]1O2 |
| InChI | InChI=1S/C22H34O4S/c23-19(16-7-3-1-2-4-8-16)11-10-18-17(20-12-13-21(18)26-20)9-5-6-14-27-15-22(24)25/h5-6,10-11,16-21,23H,1-4,7-9,12-15H2,(H,24,25)/b6-5-,11-10+/t17-,18+,19?,20-,21+/m0/s1 |
| InChIKey | IXEZUJAIJJQXNS-VZPSICJLSA-N |
| XLogP | 4.43 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.58 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|