C21H32O5 — CID 70454949
2-[(Z)-4-[(1S,2S,3R,4R)-3-[(E)-3-cyclohexyl-3-hydroxyprop-1-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]but-2-enoxy]acetic acid (PubChem CID 70454949) has the molecular formula C21H32O5 and a molecular weight of 364.48 g/mol. Its IUPAC name is 2-[(Z)-4-[(1S,2S,3R,4R)-3-[(E)-3-cyclohexyl-3-hydroxyprop-1-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]but-2-enoxy]acetic acid.
| Compound Name | 2-[(Z)-4-[(1S,2S,3R,4R)-3-[(E)-3-cyclohexyl-3-hydroxyprop-1-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]but-2-enoxy]acetic acid |
|---|---|
| PubChem CID | 70454949 |
| Molecular Formula | C21H32O5 |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | 2-[(Z)-4-[(1S,2S,3R,4R)-3-[(E)-3-cyclohexyl-3-hydroxyprop-1-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]but-2-enoxy]acetic acid |
| SMILES | O=C(O)COC/C=C\C[C@H]1[C@@H](/C=C/C(O)C2CCCCC2)[C@H]2CC[C@@H]1O2 |
| InChI | InChI=1S/C21H32O5/c22-18(15-6-2-1-3-7-15)10-9-17-16(19-11-12-20(17)26-19)8-4-5-13-25-14-21(23)24/h4-5,9-10,15-20,22H,1-3,6-8,11-14H2,(H,23,24)/b5-4-,10-9+/t16-,17+,18?,19-,20+/m0/s1 |
| InChIKey | HRNMOBLOQFMODP-OPKKJRHOSA-N |
| XLogP | 3.32 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|