C21H35NO4 — CID 54109481
7-[(1R,2R,3S,4S)-3-[(2-cyclohexyl-2-hydroxyethyl)amino]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid (PubChem CID 54109481) has the molecular formula C21H35NO4 and a molecular weight of 365.51 g/mol. Its IUPAC name is 7-[(1R,2R,3S,4S)-3-[(2-cyclohexyl-2-hydroxyethyl)amino]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2R,3S,4S)-3-[(2-cyclohexyl-2-hydroxyethyl)amino]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 54109481 |
| Molecular Formula | C21H35NO4 |
| Molecular Weight | 365.51 g/mol |
| Exact Mass | 365.26 |
| IUPAC Name | 7-[(1R,2R,3S,4S)-3-[(2-cyclohexyl-2-hydroxyethyl)amino]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
| SMILES | O=C(O)CCCC=CC[C@@H]1[C@H](NCC(O)C2CCCCC2)[C@@H]2CC[C@H]1O2 |
| InChI | InChI=1S/C21H35NO4/c23-17(15-8-4-3-5-9-15)14-22-21-16(18-12-13-19(21)26-18)10-6-1-2-7-11-20(24)25/h1,6,15-19,21-23H,2-5,7-14H2,(H,24,25)/t16-,17?,18+,19-,21-/m0/s1 |
| InChIKey | NGBLQNRUQYMDRL-LTLAHRBNSA-N |
| XLogP | 3.26 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.51 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|