C19H30O4S — CID 70510167
(Z)-7-[(1R,2R,3S,4S)-3-(cyclopentylsulfinylmethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid (PubChem CID 70510167) has the molecular formula C19H30O4S and a molecular weight of 354.51 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3S,4S)-3-(cyclopentylsulfinylmethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,3S,4S)-3-(cyclopentylsulfinylmethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70510167 |
| Molecular Formula | C19H30O4S |
| Molecular Weight | 354.51 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | (Z)-7-[(1R,2R,3S,4S)-3-(cyclopentylsulfinylmethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\C[C@@H]1[C@H](CS(=O)C2CCCC2)[C@@H]2CC[C@H]1O2 |
| InChI | InChI=1S/C19H30O4S/c20-19(21)10-4-2-1-3-9-15-16(18-12-11-17(15)23-18)13-24(22)14-7-5-6-8-14/h1,3,14-18H,2,4-13H2,(H,20,21)/b3-1-/t15-,16+,17-,18+,24?/m1/s1 |
| InChIKey | MPZOIZJBUDPQBJ-BHPJOWKCSA-N |
| XLogP | 3.67 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.51 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|