C15H24O4S — CID 54220340
7-[(1R,2R,3S,4S)-3-(methylsulfinylmethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid (PubChem CID 54220340) has the molecular formula C15H24O4S and a molecular weight of 300.42 g/mol. Its IUPAC name is 7-[(1R,2R,3S,4S)-3-(methylsulfinylmethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2R,3S,4S)-3-(methylsulfinylmethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 54220340 |
| Molecular Formula | C15H24O4S |
| Molecular Weight | 300.42 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 7-[(1R,2R,3S,4S)-3-(methylsulfinylmethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
| SMILES | CS(=O)C[C@H]1[C@@H](CC=CCCCC(=O)O)[C@H]2CC[C@@H]1O2 |
| InChI | InChI=1S/C15H24O4S/c1-20(18)10-12-11(13-8-9-14(12)19-13)6-4-2-3-5-7-15(16)17/h2,4,11-14H,3,5-10H2,1H3,(H,16,17)/t11-,12+,13-,14+,20?/m1/s1 |
| InChIKey | QCDIXNAHXUFAOJ-ACZNIGLYSA-N |
| XLogP | 2.36 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.42 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|