C21H35NO5S — CID 57082463
7-[3-[2-cyclohexylethyl(sulfino)amino]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid (PubChem CID 57082463) has the molecular formula C21H35NO5S and a molecular weight of 413.58 g/mol. Its IUPAC name is 7-[3-[2-cyclohexylethyl(sulfino)amino]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid.
| Compound Name | 7-[3-[2-cyclohexylethyl(sulfino)amino]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 57082463 |
| Molecular Formula | C21H35NO5S |
| Molecular Weight | 413.58 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | 7-[3-[2-cyclohexylethyl(sulfino)amino]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
| SMILES | O=C(O)CCCC=CCC1C2CCC(O2)C1N(CCC1CCCCC1)S(=O)O |
| InChI | InChI=1S/C21H35NO5S/c23-20(24)11-7-2-1-6-10-17-18-12-13-19(27-18)21(17)22(28(25)26)15-14-16-8-4-3-5-9-16/h1,6,16-19,21H,2-5,7-15H2,(H,23,24)(H,25,26) |
| InChIKey | GFIINCYSZTZZBL-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.58 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|