C26H42O5S — CID 70482036
(Z)-7-[(1R,2R,3S,4S)-3-[(5-cyclohexyl-2-methylpent-2-enyl)sulfonylmethyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid (PubChem CID 70482036) has the molecular formula C26H42O5S and a molecular weight of 466.68 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3S,4S)-3-[(5-cyclohexyl-2-methylpent-2-enyl)sulfonylmethyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,3S,4S)-3-[(5-cyclohexyl-2-methylpent-2-enyl)sulfonylmethyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70482036 |
| Molecular Formula | C26H42O5S |
| Molecular Weight | 466.68 g/mol |
| Exact Mass | 466.28 |
| IUPAC Name | (Z)-7-[(1R,2R,3S,4S)-3-[(5-cyclohexyl-2-methylpent-2-enyl)sulfonylmethyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
| SMILES | CC(=CCCC1CCCCC1)CS(=O)(=O)C[C@H]1[C@@H](C/C=C\CCCC(=O)O)[C@H]2CC[C@@H]1O2 |
| InChI | InChI=1S/C26H42O5S/c1-20(10-9-13-21-11-5-4-6-12-21)18-32(29,30)19-23-22(24-16-17-25(23)31-24)14-7-2-3-8-15-26(27)28/h2,7,10,21-25H,3-6,8-9,11-19H2,1H3,(H,27,28)/b7-2-,20-10?/t22-,23+,24-,25+/m1/s1 |
| InChIKey | MYYIPRHTGCDBJF-WWMDLDHVSA-N |
| XLogP | 5.70 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.68 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|