C21H34O3S — CID 70482793
(Z)-7-[(1R,2R,3S,4S)-3-(2-hex-3-enylsulfanylethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid (PubChem CID 70482793) has the molecular formula C21H34O3S and a molecular weight of 366.57 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3S,4S)-3-(2-hex-3-enylsulfanylethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,3S,4S)-3-(2-hex-3-enylsulfanylethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70482793 |
| Molecular Formula | C21H34O3S |
| Molecular Weight | 366.57 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | (Z)-7-[(1R,2R,3S,4S)-3-(2-hex-3-enylsulfanylethyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
| SMILES | CCC=CCCSCC[C@H]1[C@@H](C/C=C\CCCC(=O)O)[C@H]2CC[C@@H]1O2 |
| InChI | InChI=1S/C21H34O3S/c1-2-3-4-9-15-25-16-14-18-17(19-12-13-20(18)24-19)10-7-5-6-8-11-21(22)23/h3-5,7,17-20H,2,6,8-16H2,1H3,(H,22,23)/b4-3?,7-5-/t17-,18+,19-,20+/m1/s1 |
| InChIKey | PRMWQDXGKSJURN-HHRYXKPGSA-N |
| XLogP | 5.46 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.57 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|