C24H35NO3S — CID 70487268
(Z)-7-[(1R,2R,3R,4S)-3-[2-(3-anilinopropylsulfanyl)ethyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid (PubChem CID 70487268) has the molecular formula C24H35NO3S and a molecular weight of 417.62 g/mol. Its IUPAC name is (Z)-7-[(1R,2R,3R,4S)-3-[2-(3-anilinopropylsulfanyl)ethyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid.
| Compound Name | (Z)-7-[(1R,2R,3R,4S)-3-[2-(3-anilinopropylsulfanyl)ethyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 70487268 |
| Molecular Formula | C24H35NO3S |
| Molecular Weight | 417.62 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | (Z)-7-[(1R,2R,3R,4S)-3-[2-(3-anilinopropylsulfanyl)ethyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
| SMILES | O=C(O)CCC/C=C\C[C@@H]1[C@@H](CCSCCCNc2ccccc2)[C@@H]2CC[C@H]1O2 |
| InChI | InChI=1S/C24H35NO3S/c26-24(27)12-7-2-1-6-11-20-21(23-14-13-22(20)28-23)15-18-29-17-8-16-25-19-9-4-3-5-10-19/h1,3-6,9-10,20-23,25H,2,7-8,11-18H2,(H,26,27)/b6-1-/t20-,21-,22-,23+/m1/s1 |
| InChIKey | VYIXMDOBYBXOGT-SJIVUJEVSA-N |
| XLogP | 5.61 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.62 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|