C19H33NO3 — CID 54276704
7-[(1R,2R,3S,4S)-3-(hexylamino)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid (PubChem CID 54276704) has the molecular formula C19H33NO3 and a molecular weight of 323.48 g/mol. Its IUPAC name is 7-[(1R,2R,3S,4S)-3-(hexylamino)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid.
| Compound Name | 7-[(1R,2R,3S,4S)-3-(hexylamino)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
|---|---|
| PubChem CID | 54276704 |
| Molecular Formula | C19H33NO3 |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.25 |
| IUPAC Name | 7-[(1R,2R,3S,4S)-3-(hexylamino)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-enoic acid |
| SMILES | CCCCCCN[C@H]1[C@@H](CC=CCCCC(=O)O)[C@H]2CC[C@@H]1O2 |
| InChI | InChI=1S/C19H33NO3/c1-2-3-4-9-14-20-19-15(16-12-13-17(19)23-16)10-7-5-6-8-11-18(21)22/h5,7,15-17,19-20H,2-4,6,8-14H2,1H3,(H,21,22)/t15-,16+,17-,19-/m0/s1 |
| InChIKey | RNXGZSLYLCYTPU-ZMMAXQRCSA-N |
| XLogP | 3.90 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|