C22H30O5 — CID 18597570
4-[2-[(1S,2S,3R,4R)-3-[(E)-3-hydroxy-4-phenylbut-1-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]ethoxy]butanoic acid (PubChem CID 18597570) has the molecular formula C22H30O5 and a molecular weight of 374.48 g/mol. Its IUPAC name is 4-[2-[(1S,2S,3R,4R)-3-[(E)-3-hydroxy-4-phenylbut-1-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]ethoxy]butanoic acid.
| Compound Name | 4-[2-[(1S,2S,3R,4R)-3-[(E)-3-hydroxy-4-phenylbut-1-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]ethoxy]butanoic acid |
|---|---|
| PubChem CID | 18597570 |
| Molecular Formula | C22H30O5 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | 4-[2-[(1S,2S,3R,4R)-3-[(E)-3-hydroxy-4-phenylbut-1-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]ethoxy]butanoic acid |
| SMILES | O=C(O)CCCOCC[C@H]1[C@@H](/C=C/C(O)Cc2ccccc2)[C@H]2CC[C@@H]1O2 |
| InChI | InChI=1S/C22H30O5/c23-17(15-16-5-2-1-3-6-16)8-9-18-19(21-11-10-20(18)27-21)12-14-26-13-4-7-22(24)25/h1-3,5-6,8-9,17-21,23H,4,7,10-15H2,(H,24,25)/b9-8+/t17?,18-,19+,20-,21+/m1/s1 |
| InChIKey | MIRFONGRYYNJHZ-KDNFWLILSA-N |
| XLogP | 3.21 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|