C23H30O3 — CID 70481532
(2E,5Z)-7-[(1R,2R,3S,4S)-3-[(E)-3-hydroxy-4-phenylbut-1-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hepta-2,5-dien-3-ol (PubChem CID 70481532) has the molecular formula C23H30O3 and a molecular weight of 354.49 g/mol. Its IUPAC name is (2E,5Z)-7-[(1R,2R,3S,4S)-3-[(E)-3-hydroxy-4-phenylbut-1-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hepta-2,5-dien-3-ol.
| Compound Name | (2E,5Z)-7-[(1R,2R,3S,4S)-3-[(E)-3-hydroxy-4-phenylbut-1-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hepta-2,5-dien-3-ol |
|---|---|
| PubChem CID | 70481532 |
| Molecular Formula | C23H30O3 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | (2E,5Z)-7-[(1R,2R,3S,4S)-3-[(E)-3-hydroxy-4-phenylbut-1-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hepta-2,5-dien-3-ol |
| SMILES | C/C=C(/O)C/C=C\C[C@@H]1[C@H](/C=C/C(O)Cc2ccccc2)[C@@H]2CC[C@H]1O2 |
| InChI | InChI=1S/C23H30O3/c1-2-18(24)10-6-7-11-20-21(23-15-14-22(20)26-23)13-12-19(25)16-17-8-4-3-5-9-17/h2-9,12-13,19-25H,10-11,14-16H2,1H3/b7-6-,13-12+,18-2+/t19?,20-,21+,22-,23+/m1/s1 |
| InChIKey | HARKDZGEORMILD-RMEDTIDISA-N |
| XLogP | 4.74 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|