C22H36O3 — CID 70482009
(E)-1-[(1S,2S,3R,4R)-3-[(2Z,5E)-5-hydroxyhepta-2,5-dienyl]-7-oxabicyclo[2.2.1]heptan-2-yl]non-1-en-3-ol (PubChem CID 70482009) has the molecular formula C22H36O3 and a molecular weight of 348.53 g/mol. Its IUPAC name is (E)-1-[(1S,2S,3R,4R)-3-[(2Z,5E)-5-hydroxyhepta-2,5-dienyl]-7-oxabicyclo[2.2.1]heptan-2-yl]non-1-en-3-ol.
| Compound Name | (E)-1-[(1S,2S,3R,4R)-3-[(2Z,5E)-5-hydroxyhepta-2,5-dienyl]-7-oxabicyclo[2.2.1]heptan-2-yl]non-1-en-3-ol |
|---|---|
| PubChem CID | 70482009 |
| Molecular Formula | C22H36O3 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.27 |
| IUPAC Name | (E)-1-[(1S,2S,3R,4R)-3-[(2Z,5E)-5-hydroxyhepta-2,5-dienyl]-7-oxabicyclo[2.2.1]heptan-2-yl]non-1-en-3-ol |
| SMILES | C/C=C(/O)C/C=C\C[C@@H]1[C@H](/C=C/C(O)CCCCCC)[C@@H]2CC[C@H]1O2 |
| InChI | InChI=1S/C22H36O3/c1-3-5-6-7-11-18(24)13-14-20-19(21-15-16-22(20)25-21)12-9-8-10-17(23)4-2/h4,8-9,13-14,18-24H,3,5-7,10-12,15-16H2,1-2H3/b9-8-,14-13+,17-4+/t18?,19-,20+,21-,22+/m1/s1 |
| InChIKey | XVCRAHXGAUXFJR-KELGVFMLSA-N |
| XLogP | 5.47 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|