C24H34O3 — CID 70487473
(2E,5Z)-7-[(1R,2R,3S,4S)-3-(3-hydroxy-4-phenylpentyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hepta-2,5-dien-3-ol (PubChem CID 70487473) has the molecular formula C24H34O3 and a molecular weight of 370.53 g/mol. Its IUPAC name is (2E,5Z)-7-[(1R,2R,3S,4S)-3-(3-hydroxy-4-phenylpentyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hepta-2,5-dien-3-ol.
| Compound Name | (2E,5Z)-7-[(1R,2R,3S,4S)-3-(3-hydroxy-4-phenylpentyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hepta-2,5-dien-3-ol |
|---|---|
| PubChem CID | 70487473 |
| Molecular Formula | C24H34O3 |
| Molecular Weight | 370.53 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | (2E,5Z)-7-[(1R,2R,3S,4S)-3-(3-hydroxy-4-phenylpentyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hepta-2,5-dien-3-ol |
| SMILES | C/C=C(/O)C/C=C\C[C@@H]1[C@H](CCC(O)C(C)c2ccccc2)[C@@H]2CC[C@H]1O2 |
| InChI | InChI=1S/C24H34O3/c1-3-19(25)11-7-8-12-20-21(24-16-15-23(20)27-24)13-14-22(26)17(2)18-9-5-4-6-10-18/h3-10,17,20-26H,11-16H2,1-2H3/b8-7-,19-3+/t17?,20-,21+,22?,23-,24+/m1/s1 |
| InChIKey | KXQRODDSZVUAEH-IHFYZJDKSA-N |
| XLogP | 5.52 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.53 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|