C22H32O3 — CID 70481703
(Z)-7-[(1S,2S,3R,4R)-3-(3-hydroxy-3-phenylpropyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-en-1-ol (PubChem CID 70481703) has the molecular formula C22H32O3 and a molecular weight of 344.50 g/mol. Its IUPAC name is (Z)-7-[(1S,2S,3R,4R)-3-(3-hydroxy-3-phenylpropyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-en-1-ol.
| Compound Name | (Z)-7-[(1S,2S,3R,4R)-3-(3-hydroxy-3-phenylpropyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-en-1-ol |
|---|---|
| PubChem CID | 70481703 |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | (Z)-7-[(1S,2S,3R,4R)-3-(3-hydroxy-3-phenylpropyl)-7-oxabicyclo[2.2.1]heptan-2-yl]hept-5-en-1-ol |
| SMILES | OCCCC/C=C\C[C@H]1[C@@H](CCC(O)c2ccccc2)[C@H]2CC[C@@H]1O2 |
| InChI | InChI=1S/C22H32O3/c23-16-8-3-1-2-7-11-18-19(22-15-14-21(18)25-22)12-13-20(24)17-9-5-4-6-10-17/h2,4-7,9-10,18-24H,1,3,8,11-16H2/b7-2-/t18-,19+,20?,21-,22+/m0/s1 |
| InChIKey | SFIMMLAWCNRALT-IAJJVSBXSA-N |
| XLogP | 4.40 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|