C22H31NO4 — CID 54235471
benzyl N-[[(1S,2R,3R,4R)-3-(7-hydroxyhept-2-enyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methyl]carbamate (PubChem CID 54235471) has the molecular formula C22H31NO4 and a molecular weight of 373.49 g/mol. Its IUPAC name is benzyl N-[[(1S,2R,3R,4R)-3-(7-hydroxyhept-2-enyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methyl]carbamate.
| Compound Name | benzyl N-[[(1S,2R,3R,4R)-3-(7-hydroxyhept-2-enyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 54235471 |
| Molecular Formula | C22H31NO4 |
| Molecular Weight | 373.49 g/mol |
| Exact Mass | 373.23 |
| IUPAC Name | benzyl N-[[(1S,2R,3R,4R)-3-(7-hydroxyhept-2-enyl)-7-oxabicyclo[2.2.1]heptan-2-yl]methyl]carbamate |
| SMILES | O=C(NC[C@H]1[C@@H](CC=CCCCCO)[C@H]2CC[C@@H]1O2)OCc1ccccc1 |
| InChI | InChI=1S/C22H31NO4/c24-14-8-3-1-2-7-11-18-19(21-13-12-20(18)27-21)15-23-22(25)26-16-17-9-5-4-6-10-17/h2,4-7,9-10,18-21,24H,1,3,8,11-16H2,(H,23,25)/t18-,19+,20-,21+/m1/s1 |
| InChIKey | QMGNYQHJOUTVSF-MHTWAQMVSA-N |
| XLogP | 3.82 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.49 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|