C21H30O4 — CID 56993061
(1S)-4-ethoxy-1-[(1S,2R,3R)-3-(3-hydroxy-3-phenylpropyl)-7-oxabicyclo[2.2.1]heptan-2-yl]but-2-en-1-ol (PubChem CID 56993061) has the molecular formula C21H30O4 and a molecular weight of 346.47 g/mol. Its IUPAC name is (1S)-4-ethoxy-1-[(1S,2R,3R)-3-(3-hydroxy-3-phenylpropyl)-7-oxabicyclo[2.2.1]heptan-2-yl]but-2-en-1-ol.
| Compound Name | (1S)-4-ethoxy-1-[(1S,2R,3R)-3-(3-hydroxy-3-phenylpropyl)-7-oxabicyclo[2.2.1]heptan-2-yl]but-2-en-1-ol |
|---|---|
| PubChem CID | 56993061 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | (1S)-4-ethoxy-1-[(1S,2R,3R)-3-(3-hydroxy-3-phenylpropyl)-7-oxabicyclo[2.2.1]heptan-2-yl]but-2-en-1-ol |
| SMILES | CCOCC=C[C@H](O)[C@@H]1[C@@H]2CCC(O2)[C@@H]1CCC(O)c1ccccc1 |
| InChI | InChI=1S/C21H30O4/c1-2-24-14-6-9-18(23)21-16(19-12-13-20(21)25-19)10-11-17(22)15-7-4-3-5-8-15/h3-9,16-23H,2,10-14H2,1H3/t16-,17?,18-,19?,20-,21+/m0/s1 |
| InChIKey | XADUXTILZAUFCS-XUCURAPOSA-N |
| XLogP | 3.25 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|