C18H30O3S — CID 57314837
1-[(2R,3R,4S)-3-[(1S)-4-ethylsulfanyl-1-hydroxybut-2-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hex-5-en-3-ol (PubChem CID 57314837) has the molecular formula C18H30O3S and a molecular weight of 326.50 g/mol. Its IUPAC name is 1-[(2R,3R,4S)-3-[(1S)-4-ethylsulfanyl-1-hydroxybut-2-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hex-5-en-3-ol.
| Compound Name | 1-[(2R,3R,4S)-3-[(1S)-4-ethylsulfanyl-1-hydroxybut-2-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hex-5-en-3-ol |
|---|---|
| PubChem CID | 57314837 |
| Molecular Formula | C18H30O3S |
| Molecular Weight | 326.50 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | 1-[(2R,3R,4S)-3-[(1S)-4-ethylsulfanyl-1-hydroxybut-2-enyl]-7-oxabicyclo[2.2.1]heptan-2-yl]hex-5-en-3-ol |
| SMILES | C=CCC(O)CC[C@H]1C2CC[C@H](O2)[C@H]1[C@@H](O)C=CCSCC |
| InChI | InChI=1S/C18H30O3S/c1-3-6-13(19)8-9-14-16-10-11-17(21-16)18(14)15(20)7-5-12-22-4-2/h3,5,7,13-20H,1,4,6,8-12H2,2H3/t13?,14-,15-,16?,17-,18+/m0/s1 |
| InChIKey | XDVPXKVHCUXTIN-NTAZQAGHSA-N |
| XLogP | 3.17 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.50 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|