About (4S)-oct-1-en-7-yn-4-ol
(4S)-oct-1-en-7-yn-4-ol (PubChem CID 101065772) has the molecular formula C8H12O
and a molecular weight of 124.18 g/mol. Its IUPAC name is (4S)-oct-1-en-7-yn-4-ol.
Molecular Properties
| Compound Name | (4S)-oct-1-en-7-yn-4-ol |
| PubChem CID | 101065772 |
| Molecular Formula | C8H12O |
| Molecular Weight | 124.18 g/mol |
| Exact Mass | 124.09 |
| IUPAC Name | (4S)-oct-1-en-7-yn-4-ol |
| SMILES | C#CCC[C@H](O)CC=C |
| InChI | InChI=1S/C8H12O/c1-3-5-7-8(9)6-4-2/h1,4,8-9H,2,5-7H2/t8-/m1/s1 |
| InChIKey | KSWNZTXYXRDYAM-MRVPVSSYSA-N |
| XLogP | 1.34 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.18 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (4S)-oct-1-en-7-yn-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-oct-1-en-7-yn-4-ol?
The IUPAC name of (4S)-oct-1-en-7-yn-4-ol (CID 101065772) is (4S)-oct-1-en-7-yn-4-ol.
What is the SMILES notation for (4S)-oct-1-en-7-yn-4-ol?
The canonical SMILES for (4S)-oct-1-en-7-yn-4-ol is C#CCC[C@H](O)CC=C.
What is the InChIKey of (4S)-oct-1-en-7-yn-4-ol?
The InChIKey is KSWNZTXYXRDYAM-MRVPVSSYSA-N. The full InChI is InChI=1S/C8H12O/c1-3-5-7-8(9)6-4-2/h1,4,8-9H,2,5-7H2/t8-/m1/s1.
What are the key properties of (4S)-oct-1-en-7-yn-4-ol?
(4S)-oct-1-en-7-yn-4-ol has a molecular weight of 124.18 g/mol, XLogP of 1.34, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-oct-1-en-7-yn-4-ol is sourced from PubChem (CID 101065772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).