About (2R,3R)-hept-6-yne-1,2,3-triol
(2R,3R)-hept-6-yne-1,2,3-triol (PubChem CID 10877233) has the molecular formula C7H12O3
and a molecular weight of 144.17 g/mol. Its IUPAC name is (2R,3R)-hept-6-yne-1,2,3-triol.
Molecular Properties
| Compound Name | (2R,3R)-hept-6-yne-1,2,3-triol |
| PubChem CID | 10877233 |
| Molecular Formula | C7H12O3 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.08 |
| IUPAC Name | (2R,3R)-hept-6-yne-1,2,3-triol |
| SMILES | C#CCC[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C7H12O3/c1-2-3-4-6(9)7(10)5-8/h1,6-10H,3-5H2/t6-,7-/m1/s1 |
| InChIKey | PLIHLCJOHANWPE-RNFRBKRXSA-N |
| XLogP | -0.89 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (2R,3R)-hept-6-yne-1,2,3-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3R)-hept-6-yne-1,2,3-triol?
The IUPAC name of (2R,3R)-hept-6-yne-1,2,3-triol (CID 10877233) is (2R,3R)-hept-6-yne-1,2,3-triol.
What is the SMILES notation for (2R,3R)-hept-6-yne-1,2,3-triol?
The canonical SMILES for (2R,3R)-hept-6-yne-1,2,3-triol is C#CCC[C@@H](O)[C@H](O)CO.
What is the InChIKey of (2R,3R)-hept-6-yne-1,2,3-triol?
The InChIKey is PLIHLCJOHANWPE-RNFRBKRXSA-N. The full InChI is InChI=1S/C7H12O3/c1-2-3-4-6(9)7(10)5-8/h1,6-10H,3-5H2/t6-,7-/m1/s1.
What are the key properties of (2R,3R)-hept-6-yne-1,2,3-triol?
(2R,3R)-hept-6-yne-1,2,3-triol has a molecular weight of 144.17 g/mol, XLogP of -0.89, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3R)-hept-6-yne-1,2,3-triol is sourced from PubChem (CID 10877233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).