C7H12O3 — CID 10877233
(2R,3R)-hept-6-yne-1,2,3-triol (PubChem CID 10877233) has the molecular formula C7H12O3 and a molecular weight of 144.17 g/mol. Its IUPAC name is (2R,3R)-hept-6-yne-1,2,3-triol.
| Compound Name | (2R,3R)-hept-6-yne-1,2,3-triol |
|---|---|
| PubChem CID | 10877233 |
| Molecular Formula | C7H12O3 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.08 |
| IUPAC Name | (2R,3R)-hept-6-yne-1,2,3-triol |
| SMILES | C#CCC[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C7H12O3/c1-2-3-4-6(9)7(10)5-8/h1,6-10H,3-5H2/t6-,7-/m1/s1 |
| InChIKey | PLIHLCJOHANWPE-RNFRBKRXSA-N |
| XLogP | -0.89 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|