C5H8O3 — CID 131065464
(2R,3S)-pent-4-yne-1,2,3-triol (PubChem CID 131065464) has the molecular formula C5H8O3 and a molecular weight of 116.12 g/mol. Its IUPAC name is (2R,3S)-pent-4-yne-1,2,3-triol.
| Compound Name | (2R,3S)-pent-4-yne-1,2,3-triol |
|---|---|
| PubChem CID | 131065464 |
| Molecular Formula | C5H8O3 |
| Molecular Weight | 116.12 g/mol |
| Exact Mass | 116.05 |
| IUPAC Name | (2R,3S)-pent-4-yne-1,2,3-triol |
| SMILES | C#C[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C5H8O3/c1-2-4(7)5(8)3-6/h1,4-8H,3H2/t4-,5+/m0/s1 |
| InChIKey | AGZXVIPOGMXNMM-CRCLSJGQSA-N |
| XLogP | -1.67 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 116.12 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|