C5H9NO2 — CID 146631040
(2S,3R)-2-aminopent-4-yne-1,3-diol (PubChem CID 146631040) has the molecular formula C5H9NO2 and a molecular weight of 115.13 g/mol. Its IUPAC name is (2S,3R)-2-aminopent-4-yne-1,3-diol.
| Compound Name | (2S,3R)-2-aminopent-4-yne-1,3-diol |
|---|---|
| PubChem CID | 146631040 |
| Molecular Formula | C5H9NO2 |
| Molecular Weight | 115.13 g/mol |
| Exact Mass | 115.06 |
| IUPAC Name | (2S,3R)-2-aminopent-4-yne-1,3-diol |
| SMILES | C#C[C@@H](O)[C@@H](N)CO |
| InChI | InChI=1S/C5H9NO2/c1-2-5(8)4(6)3-7/h1,4-5,7-8H,3,6H2/t4-,5+/m0/s1 |
| InChIKey | NKROBXITHIVCSO-CRCLSJGQSA-N |
| XLogP | -1.70 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 115.13 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|