C5H13NO4 — CID 126485687
(2S,3R,4R)-4-aminopentane-1,2,3,5-tetrol (PubChem CID 126485687) has the molecular formula C5H13NO4 and a molecular weight of 151.16 g/mol. Its IUPAC name is (2S,3R,4R)-4-aminopentane-1,2,3,5-tetrol.
| Compound Name | (2S,3R,4R)-4-aminopentane-1,2,3,5-tetrol |
|---|---|
| PubChem CID | 126485687 |
| Molecular Formula | C5H13NO4 |
| Molecular Weight | 151.16 g/mol |
| Exact Mass | 151.08 |
| IUPAC Name | (2S,3R,4R)-4-aminopentane-1,2,3,5-tetrol |
| SMILES | N[C@H](CO)[C@@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C5H13NO4/c6-3(1-7)5(10)4(9)2-8/h3-5,7-10H,1-2,6H2/t3-,4+,5-/m1/s1 |
| InChIKey | VMWHZZCFIPURJF-MROZADKFSA-N |
| XLogP | -2.98 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.16 |
| LogP ≤ 5 | -2.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |