C6H15NO4S — CID 87770507
(2R,3R,4R,5R)-5-amino-6-sulfanylhexane-1,2,3,4-tetrol (PubChem CID 87770507) has the molecular formula C6H15NO4S and a molecular weight of 197.26 g/mol. Its IUPAC name is (2R,3R,4R,5R)-5-amino-6-sulfanylhexane-1,2,3,4-tetrol.
| Compound Name | (2R,3R,4R,5R)-5-amino-6-sulfanylhexane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 87770507 |
| Molecular Formula | C6H15NO4S |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | (2R,3R,4R,5R)-5-amino-6-sulfanylhexane-1,2,3,4-tetrol |
| SMILES | N[C@@H](CS)[C@@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H15NO4S/c7-3(2-12)5(10)6(11)4(9)1-8/h3-6,8-12H,1-2,7H2/t3-,4+,5+,6-/m0/s1 |
| InChIKey | JZSRAQLUQFFJJX-KCDKBNATSA-N |
| XLogP | -2.68 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | -2.68 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|