C8H19NO4 — CID 46237758
(2S,3S,4S,5R)-5-aminooctane-1,2,3,4-tetrol (PubChem CID 46237758) has the molecular formula C8H19NO4 and a molecular weight of 193.24 g/mol. Its IUPAC name is (2S,3S,4S,5R)-5-aminooctane-1,2,3,4-tetrol.
| Compound Name | (2S,3S,4S,5R)-5-aminooctane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 46237758 |
| Molecular Formula | C8H19NO4 |
| Molecular Weight | 193.24 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | (2S,3S,4S,5R)-5-aminooctane-1,2,3,4-tetrol |
| SMILES | CCC[C@@H](N)[C@H](O)[C@H](O)[C@@H](O)CO |
| InChI | InChI=1S/C8H19NO4/c1-2-3-5(9)7(12)8(13)6(11)4-10/h5-8,10-13H,2-4,9H2,1H3/t5-,6+,7+,8-/m1/s1 |
| InChIKey | CGDLSOCCDRJKNX-VGRMVHKJSA-N |
| XLogP | -1.81 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.24 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |