C5H13NO5 — CID 139898597
(2S,3S,4R)-1-aminopentane-1,2,3,4,5-pentol (PubChem CID 139898597) has the molecular formula C5H13NO5 and a molecular weight of 167.16 g/mol. Its IUPAC name is (2S,3S,4R)-1-aminopentane-1,2,3,4,5-pentol.
| Compound Name | (2S,3S,4R)-1-aminopentane-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 139898597 |
| Molecular Formula | C5H13NO5 |
| Molecular Weight | 167.16 g/mol |
| Exact Mass | 167.08 |
| IUPAC Name | (2S,3S,4R)-1-aminopentane-1,2,3,4,5-pentol |
| SMILES | NC(O)[C@@H](O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C5H13NO5/c6-5(11)4(10)3(9)2(8)1-7/h2-5,7-11H,1,6H2/t2-,3+,4+,5?/m1/s1 |
| InChIKey | RHMZEZFUUWYJOV-AGQMPKSLSA-N |
| XLogP | -3.66 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.16 |
| LogP ≤ 5 | -3.66 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|