C6H15NO6 — CID 139898603
(2S,3R,4R,5R)-1-aminohexane-1,2,3,4,5,6-hexol (PubChem CID 139898603) has the molecular formula C6H15NO6 and a molecular weight of 197.19 g/mol. Its IUPAC name is (2S,3R,4R,5R)-1-aminohexane-1,2,3,4,5,6-hexol.
| Compound Name | (2S,3R,4R,5R)-1-aminohexane-1,2,3,4,5,6-hexol |
|---|---|
| PubChem CID | 139898603 |
| Molecular Formula | C6H15NO6 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | (2S,3R,4R,5R)-1-aminohexane-1,2,3,4,5,6-hexol |
| SMILES | NC(O)[C@@H](O)[C@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H15NO6/c7-6(13)5(12)4(11)3(10)2(9)1-8/h2-6,8-13H,1,7H2/t2-,3-,4-,5+,6?/m1/s1 |
| InChIKey | KULQACNMKIDJNN-RSVSWTKNSA-N |
| XLogP | -4.30 |
| TPSA | 147.40 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | -4.30 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|