C2H7NO2 — CID 140649256
(1R)-1-aminoethane-1,2-diol (PubChem CID 140649256) has the molecular formula C2H7NO2 and a molecular weight of 77.08 g/mol. Its IUPAC name is (1R)-1-aminoethane-1,2-diol.
| Compound Name | (1R)-1-aminoethane-1,2-diol |
|---|---|
| PubChem CID | 140649256 |
| Molecular Formula | C2H7NO2 |
| Molecular Weight | 77.08 g/mol |
| Exact Mass | 77.05 |
| IUPAC Name | (1R)-1-aminoethane-1,2-diol |
| SMILES | N[C@H](O)CO |
| InChI | InChI=1S/C2H7NO2/c3-2(5)1-4/h2,4-5H,1,3H2/t2-/m1/s1 |
| InChIKey | GODZNYBQGNSJJN-UWTATZPHSA-N |
| XLogP | -1.74 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 77.08 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|