C8H19NO3 — CID 57138819
1-amino-4-(2-hydroxyethyl)hexane-1,6-diol (PubChem CID 57138819) has the molecular formula C8H19NO3 and a molecular weight of 177.24 g/mol. Its IUPAC name is 1-amino-4-(2-hydroxyethyl)hexane-1,6-diol.
| Compound Name | 1-amino-4-(2-hydroxyethyl)hexane-1,6-diol |
|---|---|
| PubChem CID | 57138819 |
| Molecular Formula | C8H19NO3 |
| Molecular Weight | 177.24 g/mol |
| Exact Mass | 177.14 |
| IUPAC Name | 1-amino-4-(2-hydroxyethyl)hexane-1,6-diol |
| SMILES | NC(O)CCC(CCO)CCO |
| InChI | InChI=1S/C8H19NO3/c9-8(12)2-1-7(3-5-10)4-6-11/h7-8,10-12H,1-6,9H2 |
| InChIKey | GMXRCHVXWJROAE-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.24 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|